C23H44F3N2O5Tl — CID 145235799
2-methylpropane;propane;3-[[1-[6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidin-2-yl]methoxy]propylperoxythallium (PubChem CID 145235799) has the molecular formula C23H44F3N2O5Tl and a molecular weight of 689.99 g/mol. Its IUPAC name is 2-methylpropane;propane;3-[[1-[6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidin-2-yl]methoxy]propylperoxythallium.
| Compound Name | 2-methylpropane;propane;3-[[1-[6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidin-2-yl]methoxy]propylperoxythallium |
|---|---|
| PubChem CID | 145235799 |
| Molecular Formula | C23H44F3N2O5Tl |
| Molecular Weight | 689.99 g/mol |
| Exact Mass | 690.29 |
| IUPAC Name | 2-methylpropane;propane;3-[[1-[6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidin-2-yl]methoxy]propylperoxythallium |
| SMILES | CC(C)C.CCC.O=C(CCCCCNC(=O)C(F)(F)F)N1CCCC1COCCCOO[Tl] |
| InChI | InChI=1S/C16H27F3N2O5.C4H10.C3H8.Tl/c17-16(18,19)15(23)20-8-3-1-2-7-14(22)21-9-4-6-13(21)12-25-10-5-11-26-24;1-4(2)3;1-3-2;/h13,24H,1-12H2,(H,20,23);4H,1-3H3;3H2,1-2H3;/q;;;+1/p-1 |
| InChIKey | WWFWTNMAAVCNHW-UHFFFAOYSA-M |
| XLogP | 4.73 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.99 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|