C12H16F3NO3 — CID 123554694
ethyl 1-(4,4,4-trifluoro-3-methylbut-2-enoyl)pyrrolidine-2-carboxylate (PubChem CID 123554694) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is ethyl 1-(4,4,4-trifluoro-3-methylbut-2-enoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-(4,4,4-trifluoro-3-methylbut-2-enoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123554694 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | ethyl 1-(4,4,4-trifluoro-3-methylbut-2-enoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1C(=O)C=C(C)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3/c1-3-19-11(18)9-5-4-6-16(9)10(17)7-8(2)12(13,14)15/h7,9H,3-6H2,1-2H3 |
| InChIKey | XGJVPJCBKARXSZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|