C15H19ClN2O3 — CID 94610145
ethyl 2-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]acetate (PubChem CID 94610145) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 94610145 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | ethyl 2-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCC[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN2O3/c1-2-21-14(19)10-17-15(20)18-9-5-8-13(18)11-6-3-4-7-12(11)16/h3-4,6-7,13H,2,5,8-10H2,1H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | XGGRWRZMIWSZOL-ZDUSSCGKSA-N |
| XLogP | 2.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |