C21H29ClN2O3 — CID 94081052
ethyl 2-[1-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]cyclohexyl]acetate (PubChem CID 94081052) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is ethyl 2-[1-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]cyclohexyl]acetate.
| Compound Name | ethyl 2-[1-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]cyclohexyl]acetate |
|---|---|
| PubChem CID | 94081052 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | ethyl 2-[1-[[(2S)-2-(2-chlorophenyl)pyrrolidine-1-carbonyl]amino]cyclohexyl]acetate |
| SMILES | CCOC(=O)CC1(NC(=O)N2CCC[C@H]2c2ccccc2Cl)CCCCC1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-2-27-19(25)15-21(12-6-3-7-13-21)23-20(26)24-14-8-11-18(24)16-9-4-5-10-17(16)22/h4-5,9-10,18H,2-3,6-8,11-15H2,1H3,(H,23,26)/t18-/m0/s1 |
| InChIKey | WJQBGSUKFUVCJW-SFHVURJKSA-N |
| XLogP | 4.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |