C16H21ClN2O — CID 51694860
(2S)-2-(2-chlorophenyl)-N-cyclopentylpyrrolidine-1-carboxamide (PubChem CID 51694860) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is (2S)-2-(2-chlorophenyl)-N-cyclopentylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(2-chlorophenyl)-N-cyclopentylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 51694860 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (2S)-2-(2-chlorophenyl)-N-cyclopentylpyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CCCC1)N1CCC[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C16H21ClN2O/c17-14-9-4-3-8-13(14)15-10-5-11-19(15)16(20)18-12-6-1-2-7-12/h3-4,8-9,12,15H,1-2,5-7,10-11H2,(H,18,20)/t15-/m0/s1 |
| InChIKey | WJWPCGDMIVIDHG-HNNXBMFYSA-N |
| XLogP | 4.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |