C14H24N2O3 — CID 43404889
ethyl 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)acetate (PubChem CID 43404889) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is ethyl 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)acetate.
| Compound Name | ethyl 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 43404889 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | ethyl 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonylamino)acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C14H24N2O3/c1-2-19-13(17)10-15-14(18)16-9-5-7-11-6-3-4-8-12(11)16/h11-12H,2-10H2,1H3,(H,15,18) |
| InChIKey | YUNCWVGWPUOVPS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |