C12H22N2O — CID 115599238
N-propyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 115599238) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is N-propyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | N-propyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 115599238 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | N-propyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | CCCNC(=O)N1CCC2CCCCC21 |
| InChI | InChI=1S/C12H22N2O/c1-2-8-13-12(15)14-9-7-10-5-3-4-6-11(10)14/h10-11H,2-9H2,1H3,(H,13,15) |
| InChIKey | YUOLLHXGNHXAEL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |