C13H24N2S — CID 115570696
N-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioamide (PubChem CID 115570696) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is N-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 115570696 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | N-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbothioamide |
| SMILES | CCCNC(=S)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H24N2S/c1-2-9-14-13(16)15-10-5-7-11-6-3-4-8-12(11)15/h11-12H,2-10H2,1H3,(H,14,16) |
| InChIKey | ZFCVZBWOBWQSTF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|