C23H35NO3 — CID 142189672
3-phenylpropyl 1-(2,3,3-trimethylpentanoyl)piperidine-2-carboxylate (PubChem CID 142189672) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is 3-phenylpropyl 1-(2,3,3-trimethylpentanoyl)piperidine-2-carboxylate.
| Compound Name | 3-phenylpropyl 1-(2,3,3-trimethylpentanoyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 142189672 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 3-phenylpropyl 1-(2,3,3-trimethylpentanoyl)piperidine-2-carboxylate |
| SMILES | CCC(C)(C)C(C)C(=O)N1CCCCC1C(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C23H35NO3/c1-5-23(3,4)18(2)21(25)24-16-10-9-15-20(24)22(26)27-17-11-14-19-12-7-6-8-13-19/h6-8,12-13,18,20H,5,9-11,14-17H2,1-4H3 |
| InChIKey | BTXAVZSRSFOIQL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|