C25H37N3O8 — CID 142974728
4-nitrooxybutyl 1-[2-[(1-ethoxy-1-oxo-5-phenylpentan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 142974728) has the molecular formula C25H37N3O8 and a molecular weight of 507.58 g/mol. Its IUPAC name is 4-nitrooxybutyl 1-[2-[(1-ethoxy-1-oxo-5-phenylpentan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | 4-nitrooxybutyl 1-[2-[(1-ethoxy-1-oxo-5-phenylpentan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 142974728 |
| Molecular Formula | C25H37N3O8 |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 4-nitrooxybutyl 1-[2-[(1-ethoxy-1-oxo-5-phenylpentan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C(CCCc1ccccc1)NC(C)C(=O)N1CCCC1C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C25H37N3O8/c1-3-34-24(30)21(14-9-13-20-11-5-4-6-12-20)26-19(2)23(29)27-16-10-15-22(27)25(31)35-17-7-8-18-36-28(32)33/h4-6,11-12,19,21-22,26H,3,7-10,13-18H2,1-2H3 |
| InChIKey | QYEPZKQUIDWEQX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|