C24H37N3O8 — CID 70339463
4-(dihydroxyamino)oxybutyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 70339463) has the molecular formula C24H37N3O8 and a molecular weight of 495.57 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 70339463 |
| Molecular Formula | C24H37N3O8 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1CCCC1C(=O)OCCCCON(O)O |
| InChI | InChI=1S/C24H37N3O8/c1-3-33-23(29)20(14-13-19-10-5-4-6-11-19)25-18(2)22(28)26-15-9-12-21(26)24(30)34-16-7-8-17-35-27(31)32/h4-6,10-11,18,20-21,25,31-32H,3,7-9,12-17H2,1-2H3 |
| InChIKey | APQNDRGKPWFXBO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|