C27H44N4O9 — CID 89202777
2-[2-(dihydroxyamino)oxyethoxy]ethyl 1-[6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 89202777) has the molecular formula C27H44N4O9 and a molecular weight of 568.67 g/mol. Its IUPAC name is 2-[2-(dihydroxyamino)oxyethoxy]ethyl 1-[6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl 1-[6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 89202777 |
| Molecular Formula | C27H44N4O9 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 2-[2-(dihydroxyamino)oxyethoxy]ethyl 1-[6-amino-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(CCCCN)C(=O)N1CCCC1C(=O)OCCOCCON(O)O |
| InChI | InChI=1S/C27H44N4O9/c1-2-38-26(33)23(14-13-21-9-4-3-5-10-21)29-22(11-6-7-15-28)25(32)30-16-8-12-24(30)27(34)39-19-17-37-18-20-40-31(35)36/h3-5,9-10,22-24,29,35-36H,2,6-8,11-20,28H2,1H3 |
| InChIKey | LNYHKCQYULABEY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 173.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|