C36H44F3N3O10 — CID 160974779
benzyl (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate;(Z)-but-2-enedioic acid (PubChem CID 160974779) has the molecular formula C36H44F3N3O10 and a molecular weight of 735.75 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate;(Z)-but-2-enedioic acid.
| Compound Name | benzyl (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 160974779 |
| Molecular Formula | C36H44F3N3O10 |
| Molecular Weight | 735.75 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | benzyl (2S)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoyl]pyrrolidine-2-carboxylate;(Z)-but-2-enedioic acid |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](CCCCNC(=O)C(F)(F)F)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C32H40F3N3O6.C4H4O4/c1-2-43-29(40)26(19-18-23-12-5-3-6-13-23)37-25(16-9-10-20-36-31(42)32(33,34)35)28(39)38-21-11-17-27(38)30(41)44-22-24-14-7-4-8-15-24;5-3(6)1-2-4(7)8/h3-8,12-15,25-27,37H,2,9-11,16-22H2,1H3,(H,36,42);1-2H,(H,5,6)(H,7,8)/b;2-1-/t25-,26-,27-;/m0./s1 |
| InChIKey | INHBDALIMZJMFG-RQZCRXMVSA-N |
| XLogP | 3.80 |
| TPSA | 188.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.75 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|