C28H42N4O10 — CID 58862195
1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-(4-nitrooxybutoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 58862195) has the molecular formula C28H42N4O10 and a molecular weight of 594.66 g/mol. Its IUPAC name is 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-(4-nitrooxybutoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-(4-nitrooxybutoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58862195 |
| Molecular Formula | C28H42N4O10 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | 1-[2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]-6-(4-nitrooxybutoxycarbonylamino)hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)NC(CCCCNC(=O)OCCCCO[N+](=O)[O-])C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C28H42N4O10/c1-2-40-27(36)23(16-15-21-11-4-3-5-12-21)30-22(25(33)31-18-10-14-24(31)26(34)35)13-6-7-17-29-28(37)41-19-8-9-20-42-32(38)39/h3-5,11-12,22-24,30H,2,6-10,13-20H2,1H3,(H,29,37)(H,34,35) |
| InChIKey | KUCNPMJXUSSUBE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|