C26H38N4O10S2 — CID 54578189
(2S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 54578189) has the molecular formula C26H38N4O10S2 and a molecular weight of 630.74 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54578189 |
| Molecular Formula | C26H38N4O10S2 |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]-6-[2-(2-nitrooxyethyldisulfanyl)ethoxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1CCC[C@H]1C(=O)O)OCCSSCCO[N+](=O)[O-] |
| InChI | InChI=1S/C26H38N4O10S2/c31-23(29-14-6-10-22(29)25(34)35)20(28-21(24(32)33)12-11-19-7-2-1-3-8-19)9-4-5-13-27-26(36)39-15-17-41-42-18-16-40-30(37)38/h1-3,7-8,20-22,28H,4-6,9-18H2,(H,27,36)(H,32,33)(H,34,35)/t20-,21-,22-/m0/s1 |
| InChIKey | JRHIIYIFGIFVIK-FKBYEOEOSA-N |
| XLogP | 2.59 |
| TPSA | 197.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|