C21H31N3NaO5 — CID 91986718
CID 91986718 (PubChem CID 91986718) has the molecular formula C21H31N3NaO5 and a molecular weight of 428.49 g/mol.
| Compound Name | CID 91986718 |
|---|---|
| PubChem CID | 91986718 |
| Molecular Formula | C21H31N3NaO5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | — |
| SMILES | NCCCCC(NC(CCc1ccccc1)C(=O)O)C(=O)N1CCCC1C(=O)O.[Na] |
| InChI | InChI=1S/C21H31N3O5.Na/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15;/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29); |
| InChIKey | YIQJJOKNXHVFQD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|