C21H32N4O5 — CID 70056796
(2S)-1-[(2S)-6-amino-2-[(2-amino-1-carboxy-3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 70056796) has the molecular formula C21H32N4O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[(2-amino-1-carboxy-3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[(2-amino-1-carboxy-3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70056796 |
| Molecular Formula | C21H32N4O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[(2-amino-1-carboxy-3-phenylpropyl)amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](NC(C(=O)O)C(N)Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H32N4O5/c22-11-5-4-9-16(19(26)25-12-6-10-17(25)20(27)28)24-18(21(29)30)15(23)13-14-7-2-1-3-8-14/h1-3,7-8,15-18,24H,4-6,9-13,22-23H2,(H,27,28)(H,29,30)/t15?,16-,17-,18?/m0/s1 |
| InChIKey | VGONNEZKHHWAAW-SAGYGOJTSA-N |
| XLogP | 0.17 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|