C20H30N4O4 — CID 18222566
1-[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18222566) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18222566 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C20H30N4O4/c21-11-5-4-9-15(22)18(25)23-16(13-14-7-2-1-3-8-14)19(26)24-12-6-10-17(24)20(27)28/h1-3,7-8,15-17H,4-6,9-13,21-22H2,(H,23,25)(H,27,28) |
| InChIKey | AEIIJFBQVGYVEV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|