C26H41N5O5 — CID 18299015
1-[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18299015) has the molecular formula C26H41N5O5 and a molecular weight of 503.64 g/mol. Its IUPAC name is 1-[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18299015 |
| Molecular Formula | C26H41N5O5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | 1-[2-[[6-amino-2-[(2-amino-4-methylpentanoyl)amino]hexanoyl]amino]-3-phenylpropanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C26H41N5O5/c1-17(2)15-19(28)23(32)29-20(11-6-7-13-27)24(33)30-21(16-18-9-4-3-5-10-18)25(34)31-14-8-12-22(31)26(35)36/h3-5,9-10,17,19-22H,6-8,11-16,27-28H2,1-2H3,(H,29,32)(H,30,33)(H,35,36) |
| InChIKey | ORAMNOYDLCEKHU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|