C25H39N5O5 — CID 18307843
1-[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18307843) has the molecular formula C25H39N5O5 and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18307843 |
| Molecular Formula | C25H39N5O5 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 1-[2-[[2-(2,6-diaminohexanoylamino)-3-phenylpropanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CCCCN)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C25H39N5O5/c1-16(2)21(24(33)30-14-8-12-20(30)25(34)35)29-23(32)19(15-17-9-4-3-5-10-17)28-22(31)18(27)11-6-7-13-26/h3-5,9-10,16,18-21H,6-8,11-15,26-27H2,1-2H3,(H,28,31)(H,29,32)(H,34,35) |
| InChIKey | IJBTZAJJUXIYJL-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|