C21H39N5O5 — CID 18310234
1-[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18310234) has the molecular formula C21H39N5O5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 1-[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18310234 |
| Molecular Formula | C21H39N5O5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 1-[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(C(=O)N1CCCC1C(=O)O)C(C)C |
| InChI | InChI=1S/C21H39N5O5/c1-12(2)16(24-18(27)14(23)8-5-6-10-22)19(28)25-17(13(3)4)20(29)26-11-7-9-15(26)21(30)31/h12-17H,5-11,22-23H2,1-4H3,(H,24,27)(H,25,28)(H,30,31) |
| InChIKey | JJIHWNLKQDKMNJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|