C20H35N5O6 — CID 18308938
1-[1-[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 18308938) has the molecular formula C20H35N5O6 and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-[1-[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[1-[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18308938 |
| Molecular Formula | C20H35N5O6 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 1-[1-[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(O)C(NC(=O)C(N)CCCCN)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C20H35N5O6/c1-12(26)16(23-17(27)13(22)6-2-3-9-21)19(29)24-10-4-7-14(24)18(28)25-11-5-8-15(25)20(30)31/h12-16,26H,2-11,21-22H2,1H3,(H,23,27)(H,30,31) |
| InChIKey | ZVXSESPJMKNIQA-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 179.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|