C23H44N6O5 — CID 18306101
1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18306101) has the molecular formula C23H44N6O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is 1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18306101 |
| Molecular Formula | C23H44N6O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | 1-[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C23H44N6O5/c1-3-15(2)19(28-20(30)16(26)9-4-6-12-24)21(31)27-17(10-5-7-13-25)22(32)29-14-8-11-18(29)23(33)34/h15-19H,3-14,24-26H2,1-2H3,(H,27,31)(H,28,30)(H,33,34) |
| InChIKey | TXARTOYVOOVMHK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 193.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|