C18H33N5O6S — CID 18261104
1-[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 18261104) has the molecular formula C18H33N5O6S and a molecular weight of 447.56 g/mol. Its IUPAC name is 1-[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18261104 |
| Molecular Formula | C18H33N5O6S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 1-[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-hydroxybutanoyl]amino]hexanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(O)C(NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C18H33N5O6S/c1-10(24)14(22-15(25)11(20)9-30)16(26)21-12(5-2-3-7-19)17(27)23-8-4-6-13(23)18(28)29/h10-14,24,30H,2-9,19-20H2,1H3,(H,21,26)(H,22,25)(H,28,29) |
| InChIKey | UEOPVUHHAJDVFI-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 188.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|