C23H44N6O5 — CID 18306943
2-[[1-[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 18306943) has the molecular formula C23H44N6O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[[1-[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[1-[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18306943 |
| Molecular Formula | C23H44N6O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | 2-[[1-[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C23H44N6O5/c1-3-15(2)19(23(33)34)28-21(31)18-11-8-14-29(18)22(32)17(10-5-7-13-25)27-20(30)16(26)9-4-6-12-24/h15-19H,3-14,24-26H2,1-2H3,(H,27,30)(H,28,31)(H,33,34) |
| InChIKey | RWQOZQPOFFODNG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 193.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|