C20H35N5O8 — CID 18304585
5-[2-[(1-carboxy-2-hydroxypropyl)carbamoyl]pyrrolidin-1-yl]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid (PubChem CID 18304585) has the molecular formula C20H35N5O8 and a molecular weight of 473.53 g/mol. Its IUPAC name is 5-[2-[(1-carboxy-2-hydroxypropyl)carbamoyl]pyrrolidin-1-yl]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[2-[(1-carboxy-2-hydroxypropyl)carbamoyl]pyrrolidin-1-yl]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18304585 |
| Molecular Formula | C20H35N5O8 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 5-[2-[(1-carboxy-2-hydroxypropyl)carbamoyl]pyrrolidin-1-yl]-4-(2,6-diaminohexanoylamino)-5-oxopentanoic acid |
| SMILES | CC(O)C(NC(=O)C1CCCN1C(=O)C(CCC(=O)O)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C20H35N5O8/c1-11(26)16(20(32)33)24-18(30)14-6-4-10-25(14)19(31)13(7-8-15(27)28)23-17(29)12(22)5-2-3-9-21/h11-14,16,26H,2-10,21-22H2,1H3,(H,23,29)(H,24,30)(H,27,28)(H,32,33) |
| InChIKey | FWISAMGITOMBKP-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 225.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|