C22H39N5O7 — CID 22697273
2-[[1-[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid (PubChem CID 22697273) has the molecular formula C22H39N5O7 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-[[1-[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[1-[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 22697273 |
| Molecular Formula | C22H39N5O7 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 2-[[1-[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H39N5O7/c1-3-13(2)18(22(33)34)26-20(31)16-8-6-12-27(16)21(32)15(7-4-5-11-23)25-19(30)14(24)9-10-17(28)29/h13-16,18H,3-12,23-24H2,1-2H3,(H,25,30)(H,26,31)(H,28,29)(H,33,34) |
| InChIKey | GFSXTWRYINQQIP-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|