C21H37N5O7 — CID 22700462
6-amino-2-[[1-[2-[(2-amino-4-carboxybutanoyl)amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 22700462) has the molecular formula C21H37N5O7 and a molecular weight of 471.56 g/mol. Its IUPAC name is 6-amino-2-[[1-[2-[(2-amino-4-carboxybutanoyl)amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-[2-[(2-amino-4-carboxybutanoyl)amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22700462 |
| Molecular Formula | C21H37N5O7 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 6-amino-2-[[1-[2-[(2-amino-4-carboxybutanoyl)amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCC(=O)O)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C21H37N5O7/c1-12(2)17(25-18(29)13(23)8-9-16(27)28)20(31)26-11-5-7-15(26)19(30)24-14(21(32)33)6-3-4-10-22/h12-15,17H,3-11,22-23H2,1-2H3,(H,24,30)(H,25,29)(H,27,28)(H,32,33) |
| InChIKey | WKTIMXVXRQWEGV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|