C20H35N5O7 — CID 18252480
6-amino-2-[[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]hexanoic acid (PubChem CID 18252480) has the molecular formula C20H35N5O7 and a molecular weight of 457.53 g/mol. Its IUPAC name is 6-amino-2-[[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18252480 |
| Molecular Formula | C20H35N5O7 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 6-amino-2-[[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]hexanoic acid |
| SMILES | CC(C)C(NC(=O)C1CCCN1C(=O)C(N)CC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H35N5O7/c1-11(2)16(18(29)23-13(20(31)32)6-3-4-8-21)24-17(28)14-7-5-9-25(14)19(30)12(22)10-15(26)27/h11-14,16H,3-10,21-22H2,1-2H3,(H,23,29)(H,24,28)(H,26,27)(H,31,32) |
| InChIKey | QGZHLCRWMPXKKQ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|