C18H31N5O7 — CID 18252100
6-amino-2-[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid (PubChem CID 18252100) has the molecular formula C18H31N5O7 and a molecular weight of 429.47 g/mol. Its IUPAC name is 6-amino-2-[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18252100 |
| Molecular Formula | C18H31N5O7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 6-amino-2-[2-[[1-(2-amino-3-carboxypropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)C1CCCN1C(=O)C(N)CC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C18H31N5O7/c1-10(15(26)22-12(18(29)30)5-2-3-7-19)21-16(27)13-6-4-8-23(13)17(28)11(20)9-14(24)25/h10-13H,2-9,19-20H2,1H3,(H,21,27)(H,22,26)(H,24,25)(H,29,30) |
| InChIKey | WFVCCTUZTINXFN-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|