C17H31N5O5 — CID 175769238
(2S)-6-amino-2-[[(2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid (PubChem CID 175769238) has the molecular formula C17H31N5O5 and a molecular weight of 385.47 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175769238 |
| Molecular Formula | C17H31N5O5 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-1-[(2S)-2-aminopropanoyl]pyrrolidine-2-carbonyl]amino]propanoyl]amino]hexanoic acid |
| SMILES | C[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C17H31N5O5/c1-10(19)16(25)22-9-5-7-13(22)15(24)20-11(2)14(23)21-12(17(26)27)6-3-4-8-18/h10-13H,3-9,18-19H2,1-2H3,(H,20,24)(H,21,23)(H,26,27)/t10-,11-,12-,13-/m0/s1 |
| InChIKey | SGWWBKBOJXRJEP-CYDGBPFRSA-N |
| XLogP | -1.47 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|