C19H35N5O5S — CID 18238362
2-[[6-amino-2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18238362) has the molecular formula C19H35N5O5S and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-[[6-amino-2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[6-amino-2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18238362 |
| Molecular Formula | C19H35N5O5S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | 2-[[6-amino-2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)C(C)N)C(=O)O |
| InChI | InChI=1S/C19H35N5O5S/c1-12(21)18(27)24-10-5-7-15(24)17(26)22-13(6-3-4-9-20)16(25)23-14(19(28)29)8-11-30-2/h12-15H,3-11,20-21H2,1-2H3,(H,22,26)(H,23,25)(H,28,29) |
| InChIKey | CREIKUNMOTVGAM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|