C16H30N4O4S — CID 18222957
6-amino-2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 18222957) has the molecular formula C16H30N4O4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 6-amino-2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18222957 |
| Molecular Formula | C16H30N4O4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 6-amino-2-[[1-(2-amino-4-methylsulfanylbutanoyl)pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | CSCCC(N)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C16H30N4O4S/c1-25-10-7-11(18)15(22)20-9-4-6-13(20)14(21)19-12(16(23)24)5-2-3-8-17/h11-13H,2-10,17-18H2,1H3,(H,19,21)(H,23,24) |
| InChIKey | WXXNVZMWHOLNRJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|