C18H33N5O5S — CID 18490490
6-amino-2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid (PubChem CID 18490490) has the molecular formula C18H33N5O5S and a molecular weight of 431.56 g/mol. Its IUPAC name is 6-amino-2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18490490 |
| Molecular Formula | C18H33N5O5S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 6-amino-2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
| SMILES | CSCCC(NC(=O)C1CCCN1C(=O)CN)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C18H33N5O5S/c1-29-10-7-12(16(25)22-13(18(27)28)5-2-3-8-19)21-17(26)14-6-4-9-23(14)15(24)11-20/h12-14H,2-11,19-20H2,1H3,(H,21,26)(H,22,25)(H,27,28) |
| InChIKey | GXHQNVVTPZXUBH-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|