C16H29N5O5S — CID 18490463
2-[[6-amino-2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18490463) has the molecular formula C16H29N5O5S and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-[[6-amino-2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18490463 |
| Molecular Formula | C16H29N5O5S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[[6-amino-2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C1CCCN1C(=O)CN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C16H29N5O5S/c17-6-2-1-4-10(14(23)20-11(9-27)16(25)26)19-15(24)12-5-3-7-21(12)13(22)8-18/h10-12,27H,1-9,17-18H2,(H,19,24)(H,20,23)(H,25,26) |
| InChIKey | MWWBEVYZOMTIPE-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|