C19H34N6O6S — CID 18307972
2-[[5-amino-2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18307972) has the molecular formula C19H34N6O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[[5-amino-2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[5-amino-2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18307972 |
| Molecular Formula | C19H34N6O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-[[5-amino-2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-5-oxopentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(N)C(=O)N1CCCC1C(=O)NC(CCC(N)=O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C19H34N6O6S/c20-8-2-1-4-11(21)18(29)25-9-3-5-14(25)17(28)23-12(6-7-15(22)26)16(27)24-13(10-32)19(30)31/h11-14,32H,1-10,20-21H2,(H2,22,26)(H,23,28)(H,24,27)(H,30,31) |
| InChIKey | KXFOJXWIDYQXHX-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 210.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|