C17H31N5O5S — CID 18307929
2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid (PubChem CID 18307929) has the molecular formula C17H31N5O5S and a molecular weight of 417.53 g/mol. Its IUPAC name is 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18307929 |
| Molecular Formula | C17H31N5O5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-sulfanylpropanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CS)NC(=O)C1CCCN1C(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C17H31N5O5S/c1-10(17(26)27)20-14(23)12(9-28)21-15(24)13-6-4-8-22(13)16(25)11(19)5-2-3-7-18/h10-13,28H,2-9,18-19H2,1H3,(H,20,23)(H,21,24)(H,26,27) |
| InChIKey | IQWRBCLDOROPRG-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|