C19H33N5O5S — CID 18260362
6-amino-2-[[1-[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]hexanoic acid (PubChem CID 18260362) has the molecular formula C19H33N5O5S and a molecular weight of 443.57 g/mol. Its IUPAC name is 6-amino-2-[[1-[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[1-[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18260362 |
| Molecular Formula | C19H33N5O5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 6-amino-2-[[1-[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C1CCCN1C(=O)C1CCCN1C(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C19H33N5O5S/c20-8-2-1-5-13(19(28)29)22-16(25)14-6-3-9-23(14)18(27)15-7-4-10-24(15)17(26)12(21)11-30/h12-15,30H,1-11,20-21H2,(H,22,25)(H,28,29) |
| InChIKey | NJHNIZINIBIYJN-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 159.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|