C23H35N5O5S — CID 18260304
2-[[6-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18260304) has the molecular formula C23H35N5O5S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-[[6-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18260304 |
| Molecular Formula | C23H35N5O5S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[[6-amino-2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C1CCCN1C(=O)C(N)CS)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H35N5O5S/c24-11-5-4-9-17(20(29)27-18(23(32)33)13-15-7-2-1-3-8-15)26-21(30)19-10-6-12-28(19)22(31)16(25)14-34/h1-3,7-8,16-19,34H,4-6,9-14,24-25H2,(H,26,30)(H,27,29)(H,32,33) |
| InChIKey | DWZKYSOZDQDKGW-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|