C29H39N5O5 — CID 18308119
2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18308119) has the molecular formula C29H39N5O5 and a molecular weight of 537.66 g/mol. Its IUPAC name is 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18308119 |
| Molecular Formula | C29H39N5O5 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(N)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H39N5O5/c30-16-8-7-14-22(31)28(37)34-17-9-15-25(34)27(36)32-23(18-20-10-3-1-4-11-20)26(35)33-24(29(38)39)19-21-12-5-2-6-13-21/h1-6,10-13,22-25H,7-9,14-19,30-31H2,(H,32,36)(H,33,35)(H,38,39) |
| InChIKey | HHRYKHZBLXYLFB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|