C20H33N5O7 — CID 18308129
2-[[1-[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanedioic acid (PubChem CID 18308129) has the molecular formula C20H33N5O7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-[[1-[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanedioic acid.
| Compound Name | 2-[[1-[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18308129 |
| Molecular Formula | C20H33N5O7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[[1-[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H33N5O7/c21-8-2-1-5-12(22)18(29)25-10-4-7-15(25)19(30)24-9-3-6-14(24)17(28)23-13(20(31)32)11-16(26)27/h12-15H,1-11,21-22H2,(H,23,28)(H,26,27)(H,31,32) |
| InChIKey | KTSJCZDSAMHLBR-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 196.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|