C17H29N5O7 — CID 18307991
2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid (PubChem CID 18307991) has the molecular formula C17H29N5O7 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18307991 |
| Molecular Formula | C17H29N5O7 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-[[2-[[1-(2,6-diaminohexanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)N1CCCC1C(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N5O7/c18-6-2-1-4-10(19)16(27)22-7-3-5-12(22)15(26)20-9-13(23)21-11(17(28)29)8-14(24)25/h10-12H,1-9,18-19H2,(H,20,26)(H,21,23)(H,24,25)(H,28,29) |
| InChIKey | COGAQZUVHBCJFZ-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 205.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|