C13H20N4O7 — CID 18490385
2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid (PubChem CID 18490385) has the molecular formula C13H20N4O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18490385 |
| Molecular Formula | C13H20N4O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[[2-[[1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]butanedioic acid |
| SMILES | NCC(=O)N1CCCC1C(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H20N4O7/c14-5-10(19)17-3-1-2-8(17)12(22)15-6-9(18)16-7(13(23)24)4-11(20)21/h7-8H,1-6,14H2,(H,15,22)(H,16,18)(H,20,21)(H,23,24) |
| InChIKey | LPGZXZDVUASZAH-UHFFFAOYSA-N |
| XLogP | -2.90 |
| TPSA | 179.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |