C14H24N4O5 — CID 71421312
5-[[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid (PubChem CID 71421312) has the molecular formula C14H24N4O5 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-[[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 71421312 |
| Molecular Formula | C14H24N4O5 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5-[[2-[[(2S)-1-(2-aminoacetyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]pentanoic acid |
| SMILES | NCC(=O)N1CCC[C@H]1C(=O)NCC(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C14H24N4O5/c15-8-12(20)18-7-3-4-10(18)14(23)17-9-11(19)16-6-2-1-5-13(21)22/h10H,1-9,15H2,(H,16,19)(H,17,23)(H,21,22)/t10-/m0/s1 |
| InChIKey | YUAPEFJZUCRBRT-JTQLQIEISA-N |
| XLogP | -1.58 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|