C16H29N5O5 — CID 18238282
6-amino-2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18238282) has the molecular formula C16H29N5O5 and a molecular weight of 371.44 g/mol. Its IUPAC name is 6-amino-2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18238282 |
| Molecular Formula | C16H29N5O5 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 6-amino-2-[[2-[[1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CC(N)C(=O)N1CCCC1C(=O)NCC(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C16H29N5O5/c1-10(18)15(24)21-8-4-6-12(21)14(23)19-9-13(22)20-11(16(25)26)5-2-3-7-17/h10-12H,2-9,17-18H2,1H3,(H,19,23)(H,20,22)(H,25,26) |
| InChIKey | SCZLXBNMCULGKN-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 167.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|