C17H31N7O6 — CID 18750827
2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18750827) has the molecular formula C17H31N7O6 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18750827 |
| Molecular Formula | C17H31N7O6 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-[[2-[[1-(2-amino-3-hydroxybutanoyl)pyrrolidine-2-carbonyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(O)C(N)C(=O)N1CCCC1C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H31N7O6/c1-9(25)13(18)15(28)24-7-3-5-11(24)14(27)22-8-12(26)23-10(16(29)30)4-2-6-21-17(19)20/h9-11,13,25H,2-8,18H2,1H3,(H,22,27)(H,23,26)(H,29,30)(H4,19,20,21) |
| InChIKey | FYMHPHMAEGZPCQ-UHFFFAOYSA-N |
| XLogP | -3.58 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|