C14H26N6O4 — CID 173100088
(2S)-2-[[(2S)-1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 173100088) has the molecular formula C14H26N6O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 173100088 |
| Molecular Formula | C14H26N6O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (2S)-2-[[(2S)-1-(2-aminopropanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C14H26N6O4/c1-8(15)12(22)20-7-3-5-10(20)11(21)19-9(13(23)24)4-2-6-18-14(16)17/h8-10H,2-7,15H2,1H3,(H,19,21)(H,23,24)(H4,16,17,18)/t8?,9-,10-/m0/s1 |
| InChIKey | MAZZQZWCCYJQGZ-AGROOBSYSA-N |
| XLogP | -2.05 |
| TPSA | 177.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|