C17H32N6O4 — CID 88653183
(2R)-2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 88653183) has the molecular formula C17H32N6O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is (2R)-2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2R)-2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 88653183 |
| Molecular Formula | C17H32N6O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (2R)-2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CCC(C)C(N)C(=O)N1CCCC1C(=O)N[C@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H32N6O4/c1-3-10(2)13(18)15(25)23-9-5-7-12(23)14(24)22-11(16(26)27)6-4-8-21-17(19)20/h10-13H,3-9,18H2,1-2H3,(H,22,24)(H,26,27)(H4,19,20,21)/t10?,11-,12?,13?/m1/s1 |
| InChIKey | SVZFKLBRCYCIIY-QVBJCFTNSA-N |
| XLogP | -1.03 |
| TPSA | 177.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|