C22H41N7O5S — CID 18297031
2-[[2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18297031) has the molecular formula C22H41N7O5S and a molecular weight of 515.68 g/mol. Its IUPAC name is 2-[[2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18297031 |
| Molecular Formula | C22H41N7O5S |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 2-[[2-[[1-(2-amino-3-methylpentanoyl)pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCC(C)C(N)C(=O)N1CCCC1C(=O)NC(CCCN=C(N)N)C(=O)NC(CCSC)C(=O)O |
| InChI | InChI=1S/C22H41N7O5S/c1-4-13(2)17(23)20(32)29-11-6-8-16(29)19(31)27-14(7-5-10-26-22(24)25)18(30)28-15(21(33)34)9-12-35-3/h13-17H,4-12,23H2,1-3H3,(H,27,31)(H,28,30)(H,33,34)(H4,24,25,26) |
| InChIKey | REZRKEBSCJFUIS-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 206.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|