C19H35N7O6S — CID 18742941
2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18742941) has the molecular formula C19H35N7O6S and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18742941 |
| Molecular Formula | C19H35N7O6S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[[2-[[1-(2-amino-3-hydroxypropanoyl)pyrrolidine-2-carbonyl]amino]-4-methylsulfanylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(NC(=O)C1CCCN1C(=O)C(N)CO)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H35N7O6S/c1-33-9-6-12(15(28)25-13(18(31)32)4-2-7-23-19(21)22)24-16(29)14-5-3-8-26(14)17(30)11(20)10-27/h11-14,27H,2-10,20H2,1H3,(H,24,29)(H,25,28)(H,31,32)(H4,21,22,23) |
| InChIKey | ZJCQIZSNGSFAKW-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|